Tolterodine Tartrate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-02480 |
| Alternative Name(s) | NULL |
| Research Area | Tolterodine Tartrate is the tartrate salt form of tolterodine, a benzhydryl compound and a muscarinic receptor antagonist possessing both antimuscarinic and antispasmodic properties. Both tolterodine and its active metabolite, 5-hydroxymethyltolterodine, |
| Molecular Formula | C26H37NO7 |
| CAS# | 124937-52-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O[C@@H](C(O)=O)[C@@H](O)C(O)=O.OC1=C(C=C(C)C=C1)[C@@H](C2=CC=CC=C2)CCN(C(C)C)C(C)C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02480.html |
| Additional Information | NULL |