P 22077 10mM * 1mL in DMSO
P 22077 is a cell-permeable inhibitor of the ubiquitin-specific protease (IC?? = 8.6 ?M) and the closely related deubiquitinase (DUB) USP47.
Trivial name | P 22077 10mM * 1mL in DMSO |
Catalog Number | A12933-10mM-D |
Alternative Name(s) | 1-[5-[(2,4-Difluorophenyl)thio]-4-n?itro-2-thienyl]-ethanone |
Molecular Formula | C₁₂H₇F₂NO₃S₂ |
CAS# | 1247819-59-5 |
SMILES | CC(=O)C1=CC(=C(S1)SC2=C(C=C(C=C2)F)F)[N+](=O)[O-] |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/p-22077.html |