Losartan Potassium
Losartan Potassium is the potassium salt form of Losartan, which is a compeitive AT1 receptor inhibitor with IC50 value of 20 nM.
| Trivial name | MK-954; DuP 753 Potassium; DuP 753 |
| Catalog Number | CSN12515 |
| Alternative Name(s) | MK-954; DuP 753 Potassium; DuP 753 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C22H22ClKN6O |
| CAS# | 124750-99-8 |
| Purity | ≥99% |
| SMILES | [O-]CC1=C(Cl)N=C(CCCC)N1CC2=CC=C(C3=CC=CC=C3C4=NNN=N4)C=C2.[K+] |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/losartan-potassium.html |