Losartan Carboxylic Acid (EXP-3174)
Losartan Carboxylic Acid (E-3174, EXP-3174), an active carboxylic acid metabolite of Losartan, is a non-peptide angiotensin II (AT1) receptor antagonist. Losartan Carboxylic Acid inhibits the specific binding of [125I]-angiotensin II to VSMC with IC50 of 1.1 nM.
| Trivial name | E-3174 |
| Catalog Number | S5980 |
| Molecular Formula | C22H21ClN6O2 |
| CAS# | 124750-92-1 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | CCCCC1=NC(=C([N]1CC2=CC=C(C=C2)C3=CC=CC=C3C4=N[NH]N=N4)C(O)=O)Cl |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/losartan-carboxylic-acid-exp-3174-.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s5980-losartan-carboxylic-acid-chemical-structure.gif |