Nimodipine D7
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10080 |
| Alternative Name(s) | 1,4-Dihydro-2,6-dimethyl-4-(3-nitrophenyl)-3,5-pyridin) 5-(1-Methylethyl-d7) Ester; (+/-)-Nimodipine-d7; Admon-d7; BAY-e 9736-d7; Nimodipine AP-d7; Nimotop-d7; Periplum-d7; |
| Research Area | Labeled Nimodipine, intended for use as an internal standard for the quantification of Nimodipine by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 1246815-36-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C(C1=CC([N](=O)=O)=CC=C1)C(C(OC(C([2H])([2H])[2H])([2H])C([2H])([2H])[2H])=O)=C(C)N2)=C2C)OCCOC |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10080.html |
| Additional Information | NULL |
