Dapoxetine D6 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02692 |
| Alternative Name(s) | bis(D3)methyl[(1S)-3-(naphthalen-1-yloxy)-1-phenylpropyl]amine hydrchloride. |
| Research Area | Labeled Dapoxetine, intended for use as an internal standard for the quantification of Dapoxetine by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 1246814-76-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C([2H])([2H])N(C([2H])([2H])[2H])[C@H](C1=CC=CC=C1)CCOC2=CC=CC3=C2C=CC=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02692.html |
| Additional Information | NULL |