CGS 21680 HCl
CGS 21680 HCl is A2A adenosine receptor agonist with Ki value of 27 nM, which can be used to distinguish A2A- and A2B-mediated effect and shows affinity for both A1 and A3 adenosine receptors.
| Trivial name | / |
| Catalog Number | CSN18682 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C23H30ClN7O6 |
| CAS# | 124431-80-7 |
| Purity | ≥98% |
| SMILES | O=C(O)CCC1=CC=C(CCNC2=NC(N)=C3N=CN([C@@H]4O[C@H](C(NCC)=O)[C@@H](O)[C@H]4O)C3=N2)C=C1.[H]Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/cgs-21680-hcl.html |