LGK-974 10mg
LGK974 is a highly potent, selective and orally bioavailable Porcupine inhibitor (Wnt signaling antagonist) with an IC50 <1 nM in the Wnt signaling reporter assay and Porcupine binding assay.
| Trivial name | LGK-974 10mg |
| Catalog Number | A12816-10 |
| Alternative Name(s) | 2-(2',3-dimethyl-[2,4'-bipyridin]-5-yl)-N-(5-(pyrazin-2-yl)pyridin-2-yl)acetamide |
| Molecular Formula | C23H20N6O |
| CAS# | 1243244-14-5 |
| SMILES | CC1=C(N=CC(=C1)CC(=O)NC2=NC=C(C=C2)C3=NC=CN=C3)C4=CC(=NC=C4)C |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/lgk-974.html |
