Wnt-C59 10mM * 1mL in DMSO
Wnt-C59 is a very potent and highly selective Wnt signaling antagonist with an IC50 ~ 74 pM in the Wnt signaling reporter assay.
| Trivial name | Wnt-C59 10mM * 1mL in DMSO |
| Catalog Number | A12951-10mM-D |
| Alternative Name(s) | 2-(4-(2-methylpyridin-4-yl)phenyl)-N-(4-(pyridin-3-yl)phenyl)acetamide |
| Molecular Formula | C25H21N3O |
| CAS# | 1243243-89-1 |
| SMILES | CC1=NC=CC(=C1)C2=CC=C(C=C2)CC(=O)NC3=CC=C(C=C3)C4=CN=CC=C4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/wnt-c59.html |