MC-GGFG-AM-(10Me-11F-Camptothecin) intermediate-1 | MedChemExpress (MCE)
MC-GGFG-AM-(10Me-11F-Camptothecin) intermediate-1 (compound 19-2) is an intermediate for the synthesis of MC-GGFG-AM-(10Me-11F-Camptothecin) (HY-153360). Modifying groups can be added group. MC-GGFG-AM-(10Me-11F-Camptothecin) is a drug-linker conjugate used in the synthesis of ADCs[1].
| Trivial name | MC-GGFG-AM-(10Me-11F-Camptothecin) intermediate-1 |
| Catalog Number | HY-400770 |
| Research Area | Cancer |
| CAS# | 1241391-14-9 |
| Purity | ≥98.00% |
| SMILES | ClCC(C1=CC(C)=C(F)C=C1N)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mc-ggfg-am-10me-11f-camptothecin-intermediate-1.html |