Triamcinolone
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30791 |
| Alternative Name(s) | 9α-Fluoro-11β,16α,17,21-tetrahydroxy-1,4-pregnadiene-3,20-dione, 9α-Fluoro-11β,16α,17,21-tetrahydroxypregna-1,4-diene-3,20-dione, Fluoxyprednisolone |
| Research Area | Triamcinolone is a synthetic glucocorticoid with anti-inflammatory and immunomodulating properties. Upon cell entry, triamcinolone binds to and activates the glucocorticoid receptor, which leads to translocation of the ligand-receptor complex to the nucle |
| Molecular Formula | NULL |
| CAS# | 124-94-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | F[C@@]1([C@]2(C=C3)C)[C@](CCC2=CC3=O)([H])[C@@](C[C@@H](O)[C@]4(O)C(CO)=O)([H])[C@]4(C)C[C@@H]1O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30791.html |
| Additional Information | NULL |