Eprinomectin (Standard) | MedChemExpress (MCE)
Eprinomectin (Standard) is the analytical standard of Eprinomectin. This product is intended for research and analytical applications. Eprinomectin (MK-397) is an avermectin with anthelmintic, insecticidal and acaricidal activities.
| Trivial name | Eprinomectin (Standard) |
| Catalog Number | HY-12643R |
| Alternative Name(s) | MK-397 (Standard) |
| Research Area | Infection |
| CAS# | 123997-26-2 |
| Purity | ≥98.0% |
| SMILES | C[C@H]1[C@@H](NC(C)=O)[C@@H](OC)C[C@H](O[C@@H]2[C@H](C)O[C@@H](O[C@@H](/C(C)=C/C[C@@H](C3)OC4(O[C@@H]([C@@H](CC)C)[C@H](C)C=C4)C[C@H]3OC5=O)[C@@H](/C=C/C=C6CO[C@@H]7[C@@]\6(O)[C@H]5C=C(C)[C@H]7O)C)C[C@@H]2OC)O1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/eprinomectin-standard.html |