Topotecan
Topotecan is a pyranoindolizinoquinoline used as an antineoplastic agent. It is a derivative of camptothecin and works by binding to the topoisomerase I-DNA complex and preventing religation of these 328 single strand breaks. It has a role as an EC 5.99.1.2 (DNA topoisomerase) inhibitor and an antineoplastic agent.
| Catalog Number | API123948878 |
| Alternative Name(s) | Topotecan lactone Hycamptamine Hycamptin |
| Research Area | Anti-Tumor APIs |
| Molecular Formula | C23H23N3O5 |
| CAS# | 123948-87-8 |
| SMILES | CCC1(C2=C(COC1=O)C(=O)N3CC4=CC5=C(C=CC(=C5CN(C)C)O)N=C4C3=C2)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/topotecan-item-12511.html |