17(S)-HpDHA | MedChemExpress (MCE)
17(S)-HpDHA is the main 15-Lipoxygenase (LOX) isoenzyme: h15-LOX-1 and h15-LOX-2 and docosahexaenoic acid (DHA). product. 17(S)-HpDHA negatively regulates epoxide synthesis via allosteric regulation. 17(S)-HpDHA also inhibits platelet aggregation with an EC50 of approximately 1 μM[1].
| Trivial name | 17(S)-HpDHA |
| Catalog Number | HY-116124 |
| Research Area | Others |
| CAS# | 123673-33-6 |
| Purity | ≥98.0% |
| SMILES | CC/C=C\C[C@@H](/C=C/C=C\C/C=C\C/C=C\C/C=C\CCC(O)=O)OO |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/17-s-hpdha.html |