AS703026 50mg
AS703026 is a novel, selective, orally bioavailable MEK1/2 inhibitor that inhibits growth and survival of MM cells and cytokine-induced osteoclast differentiation.
| Trivial name | AS703026 50mg |
| Catalog Number | A10089-50 |
| Alternative Name(s) | N-[(2S)-2,3-Dihydroxypropyl]-3-[(2-fluoro-4-iodophenyl)amino]-4-pyridinecarboxamide |
| Molecular Formula | C15H15FIN3O3 |
| CAS# | 1236699-92-5 |
| SMILES | C1=CC(=C(C=C1I)F)NC2=C(C=CN=C2)C(=O)NC[C@@H](CO)O |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/as703026.html |
