Iguratimod (T 614) 5mg
Iguratimod(T 614) is one of a series of 4H-1-benzopyran-4-ones which has potent anti-inflammatory, analgesic and antipyretic activity. Iguratimod(T 614) is a selective inhibitor of cyclo-oxygenase-2 (COX-2), and inhibits the production of interleukin-1 (IL-1), IL-6, IL-8 and tumour necrosis factor.
| Trivial name | Iguratimod (T 614) 5mg |
| Catalog Number | A11464-5 |
| Alternative Name(s) | N-[7-methanesulfonamido-4-oxo-6-(phenoxy)chromen-3-yl]formamide |
| Molecular Formula | C17H14N2O6S |
| CAS# | 123663-49-0 |
| SMILES | CS(=O)(=O)NC1=C(C=C2C(=C1)OC=C(C2=O)NC=O)OC3=CC=CC=C3 |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/iguratimod-t-614.html |
