A-1155463
BCL-XL inhibitor, potent and selective Apoptosis|Bcl-xL
| Catalog Number | B6163-5 |
| Research Area | Apoptosis|Bcl-xL |
| Molecular Formula | C35H32FN5O4S2 |
| CAS# | 1235034-55-5 |
| Purity | 98.6% |
| SMILES | O=C(C1=C(CCCOC2=CC=C(C#CCN(C)C)C=C2F)SC(N3CC4=C(C=CC=C4C(NC5=NC6=CC=CC=C6S5)=O)CC3)=N1)O |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6163 |
