Biperiden Hydrochloride
API Standard
| Catalog Number | CS-T-49157 |
| Alternative Name(s) | ayl-1-piperidinepropanol Hyrbornen-2-yl-a-phenyl-1-piperidinepropanol Hydrochloride; Akineton Hydrochloride; Akinophyl; Biperidene Hydrochloride; NSC 170950; NSC 84989; |
| Research Area | Biperiden hydrochloride is antiparkinsonian; non-selective muscarinic receptor antagonist. Biperiden is used for the adjunctive treatment of all forms of Parkinson's Disease (postencephalitic, idiopathic, and arteriosclerotic); also commonly used to improve parkinsonian signs and symptoms related to antipsychotic drug therapy. |
| CAS# | 1235-82-1 |
| Purity | >98% |
| SMILES | OC(C1C(C=C2)CC2C1)(C3=CC=CC=C3)CCN4CCCCC4.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST49157.html |