(−)-C75 | MedChemExpress (MCE)
(−)-C75 is a isoform of C75 (HY-12364), which is a synthetic fatty-acid synthase (FASN) inhibitor; inhibits prostate cancer cells PC3 with an IC50 of 35 μM[1][2][3]. C75 is a potent CPT1A activator[5].
| Trivial name | (−)-C75 |
| Catalog Number | HY-12364B |
| Research Area | Cancer |
| CAS# | 1234694-22-4 |
| Purity | ≥98.00% |
| SMILES | CCCCCCCC[C@@H]([C@@H](C1=C)C(O)=O)OC1=O |
| PubChem Chemical Structure ID | 6482234 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/c75-1.html |