(+)-trans-C75
enantiomer of C75, a fatty acid synthase (FAS) inhibitor Others|FAS
| Catalog Number | C4741-5 |
| Alternative Name(s) | (2R,3S)-C75 |
| Research Area | Others|FAS |
| Molecular Formula | C14H22O4 |
| CAS# | 1234694-20-2 |
| Purity | 97% |
| SMILES | CCCCCCCC[C@@H](OC1=O)[C@@H](C(O)=O)C1=C |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=C4741 |
