Tenapanor 5mg
Tenapanor acts as an inhibitor of the sodium-proton exchanger NHE3. This antiporter protein is found in the kidney and intestines, and normally acts to regulate the levels of sodium absorbed and secreted by the body.
| Trivial name | Tenapanor 5mg |
| Catalog Number | A14011-5 |
| Alternative Name(s) | N,N'-(10,17,-dioxo-3,6,21,24-tetraoxa-9,11,16,18-tetraazahexacosane-1,26-diyl)bis([(4S)-6,8-dichloro-2-methyl-1,2,3,4-tetrahydroisoquinolin-4-yl]benzenesulfonamide) |
| Molecular Formula | C50H66Cl4N8O10S2 |
| CAS# | 1234423-95-0 |
| SMILES | CN1C[C@H](C2=CC(=CC(=C2C1)Cl)Cl)C3=CC(=CC=C3)S(=O)(=O)NCCOCCOCCNC(=O)NCCCCNC(=O)NCCOCCOCCNS(=O)(=O)C4=CC=CC(=C4)[C@@H]5CN(CC6=C(C=C(C=C56)Cl)Cl)C |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/tenapanor.html |
