kb NB 142-70 10mg
kb NB 142-70 is a selective protein kinase D (PKD) inhibitor (IC50 values are 28.3, 58.7 and 53.2 nM for PKD1, 2 and 3 respectively).
| Trivial name | kb NB 142-70 10mg |
| Catalog Number | A12423-10 |
| Alternative Name(s) | 9-Hydroxy-3,4-dihydro-2H-[1]-benzot?hiolo[2,3-f][1,4]thiazepin-5-one |
| Molecular Formula | C11H9NO2S2 |
| CAS# | 1233533-04-4 |
| SMILES | C1CSC2=C(C(=O)N1)SC3=C2C=C(C=C3)O |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/kb-nb-142-70.html |
