BI-69A11 | MedChemExpress (MCE)
BI-69A11 is an AKT inhibitor that can effectively suppress the phosphorylation of AKT. BI-69A11 exhibits anticancer activity and can lead to the death of melanoma cells and prostate tumor cells[1].
| Trivial name | BI-69A11 |
| Catalog Number | HY-18933 |
| Research Area | Cancer |
| CAS# | 1233322-09-2 |
| Purity | ≥98.0% |
| SMILES | O=C1NC2=C(C=C(Cl)C=C2)C(C3=CC=CC=C3)=C1C(/C=C/C4=NC5=CC=CC=C5N4)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/bi-69a11.html |