Berzosertib | MedChemExpress (MCE)
Berzosertib (VE-822) is an ATR inhibitor with a Ki value of less than 0.2 nM. It also inhibits ATM with a Ki of 34 nM.
| Trivial name | Berzosertib |
| Catalog Number | HY-13902 |
| Alternative Name(s) | VE-822; VX-970 |
| Research Area | Cancer |
| CAS# | 1232416-25-9 |
| Purity | 99.7% |
| SMILES | NC1=NC=C(C2=CC=C(S(=O)(C(C)C)=O)C=C2)N=C1C3=CC(C4=CC=C(CNC)C=C4)=NO3 |
| Size | 10 mg |
| Supplier Page | https://www.medchemexpress.com/VE-822.html |