FRAX486
p21-activated kinase (PAK) inhibitor Cell Cycle/Checkpoint|PAK1
| Catalog Number | B6165-50 |
| Research Area | Cell Cycle/Checkpoint|PAK1 |
| Molecular Formula | C25H23Cl2FN6O |
| CAS# | 1232030-35-1 |
| Purity | 99.7% |
| SMILES | O=C1C(C2=CC=C(Cl)C=C2Cl)=CC3=CN=C(NC4=CC=C(N5CCNCC5)C(F)=C4)N=C3N1CC |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6165 |
