9,11-Ethinyl Estradiol
Metabolites
| Trivial name | NULL |
| Catalog Number | CS-O-05547 |
| Alternative Name(s) | 9,11-Dehydro Ethynyl Estradiol;Ethinyl Estradiol Impurity B;USP Ethinyl Estradiol Related Compound B;(10S,11S,14S,15S)-15-methylte-1(17),2(7),3,5-tetraene-5,14-diol;9,11-Dehydroestradiol; J 1213; Zc ;Δ-9(11)-EE; Ethynylestradiol EP impurity B. |
| Research Area | An impurity and metabolite of Estradiol. |
| Molecular Formula | C20H22O2 |
| CAS# | 1231-96-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1([C@]2(O)C#C)[C@](CC2)([H])[C@@](CCC3=C4C=CC(O)=C3)([H])C4=CC1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05547.html |
| Additional Information | NULL |