(±)-2-Octanol
(±)-2-Octanol (CAS# 123-96-6) is used as a chemical reagent in the synthesis of a variety of pharmaceutical compounds usually through its oxidation to a ketone or aldehyde. Used in the synthesis of piperine derivates as MAO A & B inhibitors.
| Catalog Number | 123-96-6 |
| Alternative Name(s) | octan-2-ol |
| Molecular Formula | C8H18O |
| CAS# | 123-96-6 |
| Purity | 95% |
| Inchi | InChI=1S/C8H18O/c1-3-4-5-6-7-8(2)9/h8-9H,3-7H2,1-2H3 |
| Inchi Key | SJWFXCIHNDVPSH-UHFFFAOYSA-N |
| Size | Please inquire |
| Supplier Page | https://buildingblock.bocsci.com/product/2-octanol-cas-123-96-6-298211.html |