Hydroquinone
Hydroquinone (Quinol, 1,4-Benzenediol, 1,4-Dihydroxybenzene, HQ) is a Melanin Synthesis Inhibitor. The physiologic effect of hydroquinone is by means of Depigmenting Activity. It also posesses antioxidant properties that can cause toxicity in several organs, notably the kidney.This product is a hazardous chemical (acute toxicity/flammable/skin corrosive). Please use it while wearing a protective face mask, gloves, and clothing.
| Trivial name | Quinol, 1,4-Benzenediol, 1,4-Dihydroxybenzene, HQ |
| Catalog Number | S4580 |
| Molecular Formula | C6H6O2 |
| CAS# | 123-31-9 |
| Inchi | InChI=1S/C6H6O2/c7-5-1-2-6(8)4-3-5/h1-4,7-8H |
| Inchi Key | QIGBRXMKCJKVMJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)O |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/hydroquinone.html |
| Additional Information | https://file.selleck.cn/downloads/struct/hydroquinone-chemical-structure-s4580.gif |