URMC-099 10mM * 1mL in DMSO
URMC-099 is an orally bioavailable, brain penetrant mixed lineage kinase (MLK) inhibitor with IC50 of 19 nM, 42 nM, 14 nM, and 150 nM, for MLK1, MLK2, MLK3, and DLK, respectively.
| Trivial name | URMC-099 10mM * 1mL in DMSO |
| Catalog Number | A14219-10mM-D |
| Alternative Name(s) | 3-(1H-indol-5-yl)-5-[4-[(4-methyl-1-piperazinyl)methyl]phenyl]-1H-pyrrolo[2,3-b]pyridine |
| Molecular Formula | C27H27N5 |
| CAS# | 1229582-33-5 |
| SMILES | CN1CCN(CC1)CC2=CC=C(C=C2)C3=CN=C4C(=C3)C(=CN4)C5=CC6=C(C=C5)NC=C6 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/urmc-099.html |