Fenbendazole D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06615 |
| Alternative Name(s) | N-[6-(Phenylthio)-1H-benzimidazol-2-yl]carbamic Acid Methyl-d3 Ester; 2-[(Methoxy-d3)carbonylamino]-5-(phenylthio)benzimidazole; Axilur-d3; Fenbendazol-d3 |
| Research Area | Labeled Bendazole, intended for use as an internal standard for the quantification of Bendazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C15D3H10N3O2S |
| CAS# | 1228182-47-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(OC([2H])([2H])[2H])NC1=NC2=CC=C(C=C2N1)SC3=CC=CC=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06615.html |
| Additional Information | NULL |