CEP-32496 hydrochloride 5mg
CEP-32496 hydrochloride is a highly potent inhibitor of wild-type BRAF, V600E mutant BRAF and c-Raf with Kd values of 14 nM, 36 nM and 39 nM, respectively.
| Trivial name | CEP-32496 hydrochloride 5mg |
| Catalog Number | A15040-5 |
| Alternative Name(s) | 1-[3-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]-3-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]urea;hydrochloride |
| Molecular Formula | C24H23ClF3N5O5 |
| CAS# | 1227678-26-3 |
| SMILES | CC(C)(C1=CC(=NO1)NC(=O)NC2=CC(=CC=C2)OC3=NC=NC4=CC(=C(C=C43)OC)OC)C(F)(F)F.Cl |
| Size | 5mg |
| Supplier Page | http://www.adooq.com/cep-32496-hydrochloride.html |