AK-778-XXMU
AK-778-XXMU, a powerful DNA Binding 2 (ID2) antagonist with a K D of 129 nM, exerts multifaceted effects by inhibiting cell migration and invasion of glioma cell lines, inducing apoptosis, and significantly retarding tumor growth [1].
| Catalog Number | T61802 |
| Molecular Formula | C22H17ClN2O3 |
| CAS# | 1227045-76-2 |
| SMILES | OC1(CC(=O)c2ccccn2)C(=O)N(Cc2cccc(Cl)c2)c2ccccc12 |
| Size | 1 mg |
| Supplier Page | https://www.targetmol.com/compound/ak-778-xxmu |
| Additional Information | https://www.targetmol.com/datasheet/T61802 |
