Acamprosate D3 Calcium
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06374 |
| Alternative Name(s) | 3dcacium Salt D3 |
| Research Area | Labeled Acamprosate, intended for use as an internal standard for the quantification of Acamprosate by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 1225580-94-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=S(CCCNC(C([2H])([2H])[2H])=O)([O-])=O.[Ca+2] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06374.html |
| Additional Information | NULL |