Rigosertib (ON-01910)
Rigosertib (ON-01910) is a non-ATP-competitive inhibitor of PLK1 with IC50 of 9 nM in a cell-free assay. It shows 30-fold greater selectivity against Plk2 and no activity to Plk3. Rigosertib inhibits PI3K/Akt pathway and activates oxidative stress signals. Rigosertib induces apoptosis in various cancer cells. Phase 3.
| Trivial name | N/A | 
| Catalog Number | S1362 | 
| Molecular Formula | C32H41BrN9O2P | 
| CAS# | 1225497-78-8 | 
| Inchi | InChI=1S/C32H41BrN9O2P/c1-21-18-26(28(44-3)19-27(21)42-12-8-22(9-13-42)41-16-14-40(2)15-17-41)38-32-36-20-23(33)31(39-32)37-25-7-6-24-29(35-11-10-34-24)30(25)45(4,5)43/h6-7,10-11,18-20,22H,8-9,12-17H2 ,1-5H3,(H2,36,37,38,39) | 
| Inchi Key | ZYSKXRAGBGLELB-UHFFFAOYSA-N | 
| SMILES | CC1=CC(=C(C=C1N2CCC(CC2)N3CCN(CC3)C)OC)NC4=NC=C(C(=N4)NC5=C(C6=NC=CN=C6C=C5)P(=O)(C)C)Br | 
| Size | 10mM/1mL | 
| Supplier Page | http://www.selleckchem.com/products/ON-01910.html | 
| Additional Information | https://file.selleck.cn/downloads/struct/ON-01910-chemical-structure-S1362.gif | 
 
                    