AG 99
AG 99 is an EGF receptor kinase inhibitor with IC50 of 10 µM in the human epidermoid carcinoma cell line A431.
| Trivial name | Tyrphostin 46; Tyrphostin AG-99 |
| Catalog Number | CSN23735 |
| Alternative Name(s) | Tyrphostin 46; Tyrphostin AG-99 |
| Research Area | / |
| Molecular Formula | C10H8N2O3 |
| CAS# | 122520-85-8 |
| Purity | ≥98% |
| SMILES | O=C(N)/C(C#N)=C/C1=CC=C(O)C(O)=C1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/ag-99.html |
