Tyrphostin AG 30
Tyrphostin AG 30 is an antimicrobial peptide with angiogenic properties. It activates human mast cells through the MAPK and NF-κB pathways.
| Trivial name | AG 30 |
| Catalog Number | CSN24708 |
| Alternative Name(s) | AG 30 |
| Research Area | Infection|Immunology/Inflammation |
| Molecular Formula | C10H7NO4 |
| CAS# | 122520-79-0 |
| Purity | ≥99% |
| SMILES | O=C(O)/C(C#N)=C/C1=CC=C(O)C(O)=C1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/tyrphostin-ag-30.html |