INK 128 50mg
INK 128 is a TORC1/2 inhibitor, is also an orally bioavailable inhibitor of raptor-mTOR (TOR complex 1 or TORC1) and rictor-mTOR (TOR complex 2 or TORC2) with potential antineoplastic activity.
Trivial name | INK 128 50mg |
Catalog Number | A11461-50 |
Alternative Name(s) | 3-(2-Amino-5-benzoxazolyl)-1-(1-methylethyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
Molecular Formula | C₁₅H₁₅N₇O |
CAS# | 1224844-38-5 |
SMILES | CC(C)N1C2=C(C(=N1)C3=CC4=C(C=C3)OC(=N4)N)C(=NC=N2)N |
Size | 50mg |
Supplier Page | http://www.adooq.com/ink-128.html |