MeIQx-d3 | MedChemExpress (MCE)
MeIQx-d3 is the deuterium labeled MeIQx (HY-W355129)[1]. MeIQx is a heterocyclic amine (HAs) compound and a dietary aromatic amine, which can bind covalently to hemoglobin. MeIQx is a mutagenic compound that induces liver tumors[2].
| Trivial name | MeIQx-d3 |
| Catalog Number | HY-W355129S |
| Research Area | Cancer |
| CAS# | 122457-31-2 |
| Purity | ≥99.00% |
| SMILES | CC1=CN=C(C=C2)C(C(N=C3N)=C2N3C([2H])([2H])[2H])=N1 |
| PubChem Chemical Structure ID | 6914087 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/meiqx-d3.html |