(S)-AL-8810 | MedChemExpress (MCE)
(S)-AL 8810 is an 11β-fluoro analog of PGF2α that acts as a potent and selective antagonist at the FP receptor. (S)-AL 8810 is the C-15 epimer of AL 8810, having the
inverse, (S), or “natural” configuration at C-15 relative to AL 8810, which is 15-(R)[1].
| Trivial name | (S)-AL-8810 |
| Catalog Number | HY-100449A |
| Research Area | Endocrinology |
| CAS# | 1224444-55-6 |
| Purity | ≥98.0% |
| SMILES | O[C@@H](C1CC2=CC=CC=C2C1)/C=C/[C@@H]3[C@H]([C@H](C[C@@H]3F)O)C/C=C\CCCC(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/s-al-8810.html |