AMPPD
AMPPD is a sensitive fluorogenic substrate for alkaline phosphatase. It is mainly used for immunodetection, such as tumor markers, infectious diseases, endocrine function, hormones and other aspects of the diagnosis.
| Catalog Number | PIPB-0491 |
| Alternative Name(s) | 3-(4'-Methoxyspiro[adamantane-2,3'-[1,2]dioxetan]-4'-yl)phenyl dihydrogen phosphate 3-(2'-Spiroadamantane)-4-methoxy-4-(3''-phosphoryloxy)phenyl-1,2-dioxetane Lumigen PPD |
| Research Area | In Vitro Diagnostics Reagents |
| Molecular Formula | C18H23O7P |
| CAS# | 122341-56-4 |
| SMILES | COC1(C2(C3CC4CC(C3)CC2C4)OO1)C5=CC(=CC=C5)OP(=O)(O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/amppd-item-10609.html |