Torin 2 50mg
Torin 2 is a potent and selective mTOR inhibitor (IC50 = 2.1 nM). Displays 800-fold cellular selectivity for mTOR over PI3K (cellular EC50 values are 0.25 and 200 nM for mTOR and PI3K respectively).
| Trivial name | Torin 2 50mg |
| Catalog Number | A11586-50 |
| Alternative Name(s) | 9-(6-Amino-3-pyridinyl)-1-[3-(trifluoromethyl)phenyl]benzo[h]-1,6-naphthyridin-2(1H)-one |
| Molecular Formula | C24H15F3N4O |
| CAS# | 1223001-51-1 |
| SMILES | C1=CC(=CC(=C1)N2C(=O)C=CC3=CN=C4C=CC(=CC4=C32)C5=CN=C(C=C5)N)C(F)(F)F |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/torin-2.html |
