Zolimidine | MedChemExpress (MCE)
Zolimidine, a derivate of imidazopyridine, is an orally active antiulcer agent. Zolimidine stimulates mucus secretion in intestinal mucosal cells and enhacnes intestinal wall more resistant to ulceration. Zolimidine exhibits gastroprotective effect in duodenal ulcer research[1][2].
| Trivial name | Zolimidine |
| Catalog Number | HY-108278 |
| Research Area | Endocrinology |
| CAS# | 1222-57-7 |
| Purity | 99.65% |
| SMILES | O=S(C1=CC=C(C2=CN3C=CC=CC3=N2)C=C1)(C)=O |
| PubChem Chemical Structure ID | 14652 |
| Size | 100 mg |
| Supplier Page | https://www.medchemexpress.com/zolimidine.html |