15-PGDH-IN-2 | MedChemExpress (MCE)
15-PGDH-IN-2 (Compound 2) is a 15-PGDH inhibitor with an IC50 value of 0.274 nM. 15-PGDH-IN-2 can be used in research on hair loss, bone formation, gastric ulcer healing, and dermal wound healing[1].
| Trivial name | 15-PGDH-IN-2 |
| Catalog Number | HY-116198 |
| Research Area | Metabolic Disease |
| CAS# | 1221413-57-5 |
| Purity | ≥98.0% |
| SMILES | O=C1S/C(C(N1)=O)=C/C2=CC=C(C=C2)OCCC3=CC=CS3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/15-pgdh-in-2.html |