Meliasenin B | MedChemExpress (MCE)
Meliasenin B (compound 2) is an apotirucallane-type triterpenoid. Meliasenin B is a nature product that could be isolated from the fruits of Melia azedarach[1].
| Trivial name | Meliasenin B |
| Catalog Number | HY-N3303 |
| Research Area | Others |
| CAS# | 1221262-77-6 |
| Purity | ≥98.00% |
| SMILES | C[C@@]12[C@]([C@@]3([H])[C@](OC([C@@H]3CC/C=C(C)/C)=O)([H])C1)(CC[C@@]4([H])C2=CC([C@]5([H])[C@@]4(CC[C@@H](C5(C)C)O)C)=O)C |
| PubChem Chemical Structure ID | 46210176 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/meliasenin-b.html |