Gemcitabine HCl
Gemcitabine is a pyrimidine nucleoside analog antitumor drug that can inhibit DNA synthesis and repair, leading to cell autophagy and apoptosis. It is mainly used to treat various solid tumors such as pancreatic cancer and non-small cell lung cancer, and is often combined with chemotherapy to enhance efficacy.
| Trivial name | NSC 613327 HCl,LY-188011 HCl |
| Catalog Number | S1149 |
| Molecular Formula | C24H29N3O3S |
| CAS# | 122111-03-9 |
| Inchi | InChI=1S/C24H29N3O3S/c1-24(2,3)27-23(28)21(22(31(27,29)30)18-10-6-4-7-11-18)25-19-12-14-20(15-13-19)26-16-8-5-9-17-26/h4,6-7,10-15,25H,5,8-9,16-17H2,1-3H3 |
| Inchi Key | IVANYIPLGFVBGR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C(=O)C(=C(S1(=O)=O)C2=CC=CC=C2)NC3=CC=C(C=C3)N4CCCCC4 |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/Gemcitabine-Hydrochloride(Gemzar).html |
| Additional Information | https://file.selleck.cn/downloads/struct/Gemcitabine-Hydrochloride-chemical-structure-S1149.gif |
