Gemcitabine hydrochloride (Standard) | MedChemExpress (MCE)
Gemcitabine (hydrochloride) (Standard) is the analytical standard of Gemcitabine (hydrochloride). This product is intended for research and analytical applications. Gemcitabine Hydrochloride (LY 188011 Hydrochloride) is a pyrimidine nucleoside analog antimetabolite and an antineoplastic agent. Gemcitabine Hydrochloride inhibits DNA synthesis and repair, resulting in autophagyand apoptosis[1][2].
| Trivial name | Gemcitabine hydrochloride (Standard) |
| Catalog Number | HY-B0003R |
| Alternative Name(s) | LY 188011 hydrochloride (Standard) |
| Research Area | Cancer |
| CAS# | 122111-03-9 |
| Purity | ≥98.0% |
| SMILES | O[C@H]1C(F)(F)[C@H](N2C(N=C(N)C=C2)=O)O[C@@H]1CO.Cl |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/gemcitabine-hydrochloride-standard.html |