Sulfadimethoxine
Antimicrobial agent
| Catalog Number | B3301-50 |
| Molecular Formula | C12H14N4O4S |
| CAS# | 122-11-2 |
| Purity | 98% |
| SMILES | COC1=NC(=NC(=C1)NS(=O)(=O)C2=CC=C(C=C2)N)OC |
| Size | 50mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B3301 |
