Cysteamine D4 hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06520 |
| Alternative Name(s) | 2-Aminoethane-d4-thiol; 2-Mecaptoethylamine-d4 Hydrchloride; |
| Research Area | Labeled Cysteamine, intended for use as an internal standard for the quantification of Cysteamine by GC- or LC-mass spectrometry. |
| Molecular Formula | C2H4DClNS |
| CAS# | 1219805-04-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC([2H])([2H])C([2H])([2H])S.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06520.html |
| Additional Information | NULL |