Fluoxetine D5 Oxalate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06630 |
| Alternative Name(s) | Fluoxetine-D5 Oxalate;methyl[3-(²H5)phenyl-3-[4- (trifluoromethyl)phenoxy]propyl]amine; oxalc cid |
| Research Area | Labeled Fluoxetine, intended for use as an internal standard for the quantification of Fluoxetine by GC- or LC-mass spectrometry. |
| Molecular Formula | NULL |
| CAS# | 1219804-82-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C(O)=O)=O.CNCCC(C(C([2H])=C1[2H])=C(C([2H])=C1[2H])[2H])OC2=CC=C(C(F)(F)F)C=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06630.html |
| Additional Information | NULL |