Δ8,9-Dehydro Estrone D2
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10087 |
| Alternative Name(s) | Δ8,9-Dehydro Estrone;3-Hydroxyestra-1,3,5(10),8-tetraen-17-one-d2; Δ8-Dehydroestrone-d2; Δ8-Isoequilin-d2; 8,9-Dehydroestrone-d2; |
| Research Area | Isotope labelled ∆8,9-Dehydro Estrone a metabolite of Equilin steroid.;Labeled Estrone, intended for use as an internal standard for the quantification of Estrone by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H18D2O2 |
| CAS# | 1219799-27-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1(C2=O)[C@](CC2([2H])[2H])([H])C(CCC3=CC(O)=CC=C43)=C4CC1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10087.html |
| Additional Information | NULL |